About 2-(1-phenylpentyl)phenol
2-(1-phenylpentyl)phenol (PubChem CID 19601156) has the molecular formula C17H20O
and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-(1-phenylpentyl)phenol.
Molecular Properties
| Compound Name | 2-(1-phenylpentyl)phenol |
| PubChem CID | 19601156 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 2-(1-phenylpentyl)phenol |
| SMILES | CCCCC(c1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C17H20O/c1-2-3-11-15(14-9-5-4-6-10-14)16-12-7-8-13-17(16)18/h4-10,12-13,15,18H,2-3,11H2,1H3 |
| InChIKey | AWYPPJQLNABHII-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(1-phenylpentyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-phenylpentyl)phenol?
The IUPAC name of 2-(1-phenylpentyl)phenol (CID 19601156) is 2-(1-phenylpentyl)phenol.
What is the SMILES notation for 2-(1-phenylpentyl)phenol?
The canonical SMILES for 2-(1-phenylpentyl)phenol is CCCCC(c1ccccc1)c1ccccc1O.
What is the InChIKey of 2-(1-phenylpentyl)phenol?
The InChIKey is AWYPPJQLNABHII-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O/c1-2-3-11-15(14-9-5-4-6-10-14)16-12-7-8-13-17(16)18/h4-10,12-13,15,18H,2-3,11H2,1H3.
What are the key properties of 2-(1-phenylpentyl)phenol?
2-(1-phenylpentyl)phenol has a molecular weight of 240.35 g/mol, XLogP of 4.71, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-phenylpentyl)phenol is sourced from PubChem (CID 19601156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).