C17H28O2 — CID 67418377
2-undecan-5-ylbenzene-1,3-diol (PubChem CID 67418377) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-undecan-5-ylbenzene-1,3-diol.
| Compound Name | 2-undecan-5-ylbenzene-1,3-diol |
|---|---|
| PubChem CID | 67418377 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 2-undecan-5-ylbenzene-1,3-diol |
| SMILES | CCCCCCC(CCCC)c1c(O)cccc1O |
| InChI | InChI=1S/C17H28O2/c1-3-5-7-8-11-14(10-6-4-2)17-15(18)12-9-13-16(17)19/h9,12-14,18-19H,3-8,10-11H2,1-2H3 |
| InChIKey | NSCCEAGUUSRYFY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|