C11H16N4 — CID 103129377
1-pyrazolo[1,5-a]pyridin-3-ylbutylhydrazine (PubChem CID 103129377) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 1-pyrazolo[1,5-a]pyridin-3-ylbutylhydrazine.
| Compound Name | 1-pyrazolo[1,5-a]pyridin-3-ylbutylhydrazine |
|---|---|
| PubChem CID | 103129377 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 1-pyrazolo[1,5-a]pyridin-3-ylbutylhydrazine |
| SMILES | CCCC(NN)c1cnn2ccccc12 |
| InChI | InChI=1S/C11H16N4/c1-2-5-10(14-12)9-8-13-15-7-4-3-6-11(9)15/h3-4,6-8,10,14H,2,5,12H2,1H3 |
| InChIKey | VGPGCKWZAMBHEI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|