C15H23N3 — CID 103126570
N-methyl-1-pyrazolo[1,5-a]pyridin-3-ylheptan-1-amine (PubChem CID 103126570) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is N-methyl-1-pyrazolo[1,5-a]pyridin-3-ylheptan-1-amine.
| Compound Name | N-methyl-1-pyrazolo[1,5-a]pyridin-3-ylheptan-1-amine |
|---|---|
| PubChem CID | 103126570 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | N-methyl-1-pyrazolo[1,5-a]pyridin-3-ylheptan-1-amine |
| SMILES | CCCCCCC(NC)c1cnn2ccccc12 |
| InChI | InChI=1S/C15H23N3/c1-3-4-5-6-9-14(16-2)13-12-17-18-11-8-7-10-15(13)18/h7-8,10-12,14,16H,3-6,9H2,1-2H3 |
| InChIKey | YOTJFYPSNZVTRF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|