C13H17N3 — CID 103126360
N-ethyl-1-pyrazolo[1,5-a]pyridin-3-ylbut-3-en-1-amine (PubChem CID 103126360) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is N-ethyl-1-pyrazolo[1,5-a]pyridin-3-ylbut-3-en-1-amine.
| Compound Name | N-ethyl-1-pyrazolo[1,5-a]pyridin-3-ylbut-3-en-1-amine |
|---|---|
| PubChem CID | 103126360 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | N-ethyl-1-pyrazolo[1,5-a]pyridin-3-ylbut-3-en-1-amine |
| SMILES | C=CCC(NCC)c1cnn2ccccc12 |
| InChI | InChI=1S/C13H17N3/c1-3-7-12(14-4-2)11-10-15-16-9-6-5-8-13(11)16/h3,5-6,8-10,12,14H,1,4,7H2,2H3 |
| InChIKey | UEGAGGCNNVUJQL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|