C17H18IN3 — CID 103127281
N-ethyl-2-(4-iodophenyl)-1-pyrazolo[1,5-a]pyridin-3-ylethanamine (PubChem CID 103127281) has the molecular formula C17H18IN3 and a molecular weight of 391.26 g/mol. Its IUPAC name is N-ethyl-2-(4-iodophenyl)-1-pyrazolo[1,5-a]pyridin-3-ylethanamine.
| Compound Name | N-ethyl-2-(4-iodophenyl)-1-pyrazolo[1,5-a]pyridin-3-ylethanamine |
|---|---|
| PubChem CID | 103127281 |
| Molecular Formula | C17H18IN3 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | N-ethyl-2-(4-iodophenyl)-1-pyrazolo[1,5-a]pyridin-3-ylethanamine |
| SMILES | CCNC(Cc1ccc(I)cc1)c1cnn2ccccc12 |
| InChI | InChI=1S/C17H18IN3/c1-2-19-16(11-13-6-8-14(18)9-7-13)15-12-20-21-10-4-3-5-17(15)21/h3-10,12,16,19H,2,11H2,1H3 |
| InChIKey | FKQIAWLQTHRFOB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|