C12H13N5S — CID 103129907
[1-pyrazolo[1,5-a]pyridin-3-yl-2-(1,3-thiazol-5-yl)ethyl]hydrazine (PubChem CID 103129907) has the molecular formula C12H13N5S and a molecular weight of 259.34 g/mol. Its IUPAC name is [1-pyrazolo[1,5-a]pyridin-3-yl-2-(1,3-thiazol-5-yl)ethyl]hydrazine.
| Compound Name | [1-pyrazolo[1,5-a]pyridin-3-yl-2-(1,3-thiazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 103129907 |
| Molecular Formula | C12H13N5S |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | [1-pyrazolo[1,5-a]pyridin-3-yl-2-(1,3-thiazol-5-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1cncs1)c1cnn2ccccc12 |
| InChI | InChI=1S/C12H13N5S/c13-16-11(5-9-6-14-8-18-9)10-7-15-17-4-2-1-3-12(10)17/h1-4,6-8,11,16H,5,13H2 |
| InChIKey | HEDZJEOOYUNUHA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|