C13H13ClN4S — CID 112749793
[2-(3-chlorothiophen-2-yl)-1-pyrazolo[1,5-a]pyridin-3-ylethyl]hydrazine (PubChem CID 112749793) has the molecular formula C13H13ClN4S and a molecular weight of 292.80 g/mol. Its IUPAC name is [2-(3-chlorothiophen-2-yl)-1-pyrazolo[1,5-a]pyridin-3-ylethyl]hydrazine.
| Compound Name | [2-(3-chlorothiophen-2-yl)-1-pyrazolo[1,5-a]pyridin-3-ylethyl]hydrazine |
|---|---|
| PubChem CID | 112749793 |
| Molecular Formula | C13H13ClN4S |
| Molecular Weight | 292.80 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | [2-(3-chlorothiophen-2-yl)-1-pyrazolo[1,5-a]pyridin-3-ylethyl]hydrazine |
| SMILES | NNC(Cc1sccc1Cl)c1cnn2ccccc12 |
| InChI | InChI=1S/C13H13ClN4S/c14-10-4-6-19-13(10)7-11(17-15)9-8-16-18-5-2-1-3-12(9)18/h1-6,8,11,17H,7,15H2 |
| InChIKey | LZQUQLJZVPYCHH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.80 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|