C14H21N3 — CID 63311788
N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)hexan-1-amine (PubChem CID 63311788) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)hexan-1-amine.
| Compound Name | N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)hexan-1-amine |
|---|---|
| PubChem CID | 63311788 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)hexan-1-amine |
| SMILES | CCCCCCNCc1cnn2ccccc12 |
| InChI | InChI=1S/C14H21N3/c1-2-3-4-6-9-15-11-13-12-16-17-10-7-5-8-14(13)17/h5,7-8,10,12,15H,2-4,6,9,11H2,1H3 |
| InChIKey | MWWXTYWAKJPTRP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|