C15H23N3O2 — CID 115614347
4-(2-methoxyethoxy)-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)butan-1-amine (PubChem CID 115614347) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)butan-1-amine.
| Compound Name | 4-(2-methoxyethoxy)-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 115614347 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 4-(2-methoxyethoxy)-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)butan-1-amine |
| SMILES | COCCOCCCCNCc1cnn2ccccc12 |
| InChI | InChI=1S/C15H23N3O2/c1-19-10-11-20-9-5-3-7-16-12-14-13-17-18-8-4-2-6-15(14)18/h2,4,6,8,13,16H,3,5,7,9-12H2,1H3 |
| InChIKey | RDLBHINZYLWLES-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 47.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|