C14H21N3O2 — CID 60698046
N-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-(2-methoxyethoxy)propan-1-amine (PubChem CID 60698046) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is N-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-(2-methoxyethoxy)propan-1-amine.
| Compound Name | N-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-(2-methoxyethoxy)propan-1-amine |
|---|---|
| PubChem CID | 60698046 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | N-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-(2-methoxyethoxy)propan-1-amine |
| SMILES | COCCOCCCNCc1cn2ccccc2n1 |
| InChI | InChI=1S/C14H21N3O2/c1-18-9-10-19-8-4-6-15-11-13-12-17-7-3-2-5-14(17)16-13/h2-3,5,7,12,15H,4,6,8-11H2,1H3 |
| InChIKey | UBOCTEXYZIPZRO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 47.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|