C12H16BrN3 — CID 106844928
4-bromo-N-(imidazo[1,2-a]pyridin-2-ylmethyl)butan-1-amine (PubChem CID 106844928) has the molecular formula C12H16BrN3 and a molecular weight of 282.18 g/mol. Its IUPAC name is 4-bromo-N-(imidazo[1,2-a]pyridin-2-ylmethyl)butan-1-amine.
| Compound Name | 4-bromo-N-(imidazo[1,2-a]pyridin-2-ylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 106844928 |
| Molecular Formula | C12H16BrN3 |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 4-bromo-N-(imidazo[1,2-a]pyridin-2-ylmethyl)butan-1-amine |
| SMILES | BrCCCCNCc1cn2ccccc2n1 |
| InChI | InChI=1S/C12H16BrN3/c13-6-2-3-7-14-9-11-10-16-8-4-1-5-12(16)15-11/h1,4-5,8,10,14H,2-3,6-7,9H2 |
| InChIKey | DXDVRKKVESDQJQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|