C13H18IN3 — CID 107320212
N-(imidazo[1,2-a]pyridin-2-ylmethyl)-5-iodopentan-1-amine (PubChem CID 107320212) has the molecular formula C13H18IN3 and a molecular weight of 343.21 g/mol. Its IUPAC name is N-(imidazo[1,2-a]pyridin-2-ylmethyl)-5-iodopentan-1-amine.
| Compound Name | N-(imidazo[1,2-a]pyridin-2-ylmethyl)-5-iodopentan-1-amine |
|---|---|
| PubChem CID | 107320212 |
| Molecular Formula | C13H18IN3 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | N-(imidazo[1,2-a]pyridin-2-ylmethyl)-5-iodopentan-1-amine |
| SMILES | ICCCCCNCc1cn2ccccc2n1 |
| InChI | InChI=1S/C13H18IN3/c14-7-3-1-4-8-15-10-12-11-17-9-5-2-6-13(17)16-12/h2,5-6,9,11,15H,1,3-4,7-8,10H2 |
| InChIKey | WXEVQMVYULCNKK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|