C10H12IN3 — CID 114505443
N-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-iodoethanamine (PubChem CID 114505443) has the molecular formula C10H12IN3 and a molecular weight of 301.13 g/mol. Its IUPAC name is N-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-iodoethanamine.
| Compound Name | N-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-iodoethanamine |
|---|---|
| PubChem CID | 114505443 |
| Molecular Formula | C10H12IN3 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | N-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-iodoethanamine |
| SMILES | ICCNCc1cn2ccccc2n1 |
| InChI | InChI=1S/C10H12IN3/c11-4-5-12-7-9-8-14-6-2-1-3-10(14)13-9/h1-3,6,8,12H,4-5,7H2 |
| InChIKey | NUWFWAYHUQSVSJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|