C12H16N4O2 — CID 106236565
2-[2-(imidazo[1,2-a]pyridin-2-ylmethylamino)ethoxy]acetamide (PubChem CID 106236565) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-[2-(imidazo[1,2-a]pyridin-2-ylmethylamino)ethoxy]acetamide.
| Compound Name | 2-[2-(imidazo[1,2-a]pyridin-2-ylmethylamino)ethoxy]acetamide |
|---|---|
| PubChem CID | 106236565 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-[2-(imidazo[1,2-a]pyridin-2-ylmethylamino)ethoxy]acetamide |
| SMILES | NC(=O)COCCNCc1cn2ccccc2n1 |
| InChI | InChI=1S/C12H16N4O2/c13-11(17)9-18-6-4-14-7-10-8-16-5-2-1-3-12(16)15-10/h1-3,5,8,14H,4,6-7,9H2,(H2,13,17) |
| InChIKey | LSCAGSLDTVLHJO-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|