C12H17N3O2 — CID 60687022
N-(imidazo[1,2-a]pyridin-2-ylmethyl)-2,2-dimethoxyethanamine (PubChem CID 60687022) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is N-(imidazo[1,2-a]pyridin-2-ylmethyl)-2,2-dimethoxyethanamine.
| Compound Name | N-(imidazo[1,2-a]pyridin-2-ylmethyl)-2,2-dimethoxyethanamine |
|---|---|
| PubChem CID | 60687022 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | N-(imidazo[1,2-a]pyridin-2-ylmethyl)-2,2-dimethoxyethanamine |
| SMILES | COC(CNCc1cn2ccccc2n1)OC |
| InChI | InChI=1S/C12H17N3O2/c1-16-12(17-2)8-13-7-10-9-15-6-4-3-5-11(15)14-10/h3-6,9,12-13H,7-8H2,1-2H3 |
| InChIKey | GYXAJUQDJZNCGH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 47.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|