C13H18ClN3 — CID 66089459
4-chloro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-methylbutan-1-amine (PubChem CID 66089459) has the molecular formula C13H18ClN3 and a molecular weight of 251.76 g/mol. Its IUPAC name is 4-chloro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-methylbutan-1-amine.
| Compound Name | 4-chloro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 66089459 |
| Molecular Formula | C13H18ClN3 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 4-chloro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-methylbutan-1-amine |
| SMILES | CC(CCCl)CNCc1cn2ccccc2n1 |
| InChI | InChI=1S/C13H18ClN3/c1-11(5-6-14)8-15-9-12-10-17-7-3-2-4-13(17)16-12/h2-4,7,10-11,15H,5-6,8-9H2,1H3 |
| InChIKey | YOXBAEPMCAAVAE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|