C16H25N3 — CID 60683059
2-ethyl-N-(imidazo[1,2-a]pyridin-2-ylmethyl)hexan-1-amine (PubChem CID 60683059) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 2-ethyl-N-(imidazo[1,2-a]pyridin-2-ylmethyl)hexan-1-amine.
| Compound Name | 2-ethyl-N-(imidazo[1,2-a]pyridin-2-ylmethyl)hexan-1-amine |
|---|---|
| PubChem CID | 60683059 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 2-ethyl-N-(imidazo[1,2-a]pyridin-2-ylmethyl)hexan-1-amine |
| SMILES | CCCCC(CC)CNCc1cn2ccccc2n1 |
| InChI | InChI=1S/C16H25N3/c1-3-5-8-14(4-2)11-17-12-15-13-19-10-7-6-9-16(19)18-15/h6-7,9-10,13-14,17H,3-5,8,11-12H2,1-2H3 |
| InChIKey | IKPSXXQMKOKWIJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |