C15H22N4O — CID 119664981
N-(1-aminohexan-2-yl)-2-imidazo[1,2-a]pyridin-2-ylacetamide (PubChem CID 119664981) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2-imidazo[1,2-a]pyridin-2-ylacetamide.
| Compound Name | N-(1-aminohexan-2-yl)-2-imidazo[1,2-a]pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 119664981 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2-imidazo[1,2-a]pyridin-2-ylacetamide |
| SMILES | CCCCC(CN)NC(=O)Cc1cn2ccccc2n1 |
| InChI | InChI=1S/C15H22N4O/c1-2-3-6-12(10-16)18-15(20)9-13-11-19-8-5-4-7-14(19)17-13/h4-5,7-8,11-12H,2-3,6,9-10,16H2,1H3,(H,18,20) |
| InChIKey | XBDGZGJGBAZWEK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |