C14H24N2 — CID 7036530
(2S)-2-ethyl-N-(pyridin-2-ylmethyl)hexan-1-amine (PubChem CID 7036530) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is (2S)-2-ethyl-N-(pyridin-2-ylmethyl)hexan-1-amine.
| Compound Name | (2S)-2-ethyl-N-(pyridin-2-ylmethyl)hexan-1-amine |
|---|---|
| PubChem CID | 7036530 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | (2S)-2-ethyl-N-(pyridin-2-ylmethyl)hexan-1-amine |
| SMILES | CCCC[C@H](CC)CNCc1ccccn1 |
| InChI | InChI=1S/C14H24N2/c1-3-5-8-13(4-2)11-15-12-14-9-6-7-10-16-14/h6-7,9-10,13,15H,3-5,8,11-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | NXQKSYDDMDZBNG-ZDUSSCGKSA-N |
| XLogP | 3.39 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |