C15H26N2 — CID 81407759
2-ethyl-N-[(1R)-1-pyridin-2-ylethyl]hexan-1-amine (PubChem CID 81407759) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 2-ethyl-N-[(1R)-1-pyridin-2-ylethyl]hexan-1-amine.
| Compound Name | 2-ethyl-N-[(1R)-1-pyridin-2-ylethyl]hexan-1-amine |
|---|---|
| PubChem CID | 81407759 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 2-ethyl-N-[(1R)-1-pyridin-2-ylethyl]hexan-1-amine |
| SMILES | CCCCC(CC)CN[C@H](C)c1ccccn1 |
| InChI | InChI=1S/C15H26N2/c1-4-6-9-14(5-2)12-17-13(3)15-10-7-8-11-16-15/h7-8,10-11,13-14,17H,4-6,9,12H2,1-3H3/t13-,14?/m1/s1 |
| InChIKey | ZWSGFIOSRVKYKF-KWCCSABGSA-N |
| XLogP | 3.95 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |