C18H31N — CID 43767516
2-ethyl-N-(2-methyl-1-phenylpropyl)hexan-1-amine (PubChem CID 43767516) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is 2-ethyl-N-(2-methyl-1-phenylpropyl)hexan-1-amine.
| Compound Name | 2-ethyl-N-(2-methyl-1-phenylpropyl)hexan-1-amine |
|---|---|
| PubChem CID | 43767516 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 2-ethyl-N-(2-methyl-1-phenylpropyl)hexan-1-amine |
| SMILES | CCCCC(CC)CNC(c1ccccc1)C(C)C |
| InChI | InChI=1S/C18H31N/c1-5-7-11-16(6-2)14-19-18(15(3)4)17-12-9-8-10-13-17/h8-10,12-13,15-16,18-19H,5-7,11,14H2,1-4H3 |
| InChIKey | QAJPRPRXMOZSNO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |