C19H33N — CID 104845466
N,4-diethyl-2-methyl-1-phenyloctan-1-amine (PubChem CID 104845466) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is N,4-diethyl-2-methyl-1-phenyloctan-1-amine.
| Compound Name | N,4-diethyl-2-methyl-1-phenyloctan-1-amine |
|---|---|
| PubChem CID | 104845466 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | N,4-diethyl-2-methyl-1-phenyloctan-1-amine |
| SMILES | CCCCC(CC)CC(C)C(NCC)c1ccccc1 |
| InChI | InChI=1S/C19H33N/c1-5-8-12-17(6-2)15-16(4)19(20-7-3)18-13-10-9-11-14-18/h9-11,13-14,16-17,19-20H,5-8,12,15H2,1-4H3 |
| InChIKey | WMZPBIMWDBHBDG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |