C10H16N2O — CID 2772086
3-(1-pyridin-2-ylethylamino)propan-1-ol (PubChem CID 2772086) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-(1-pyridin-2-ylethylamino)propan-1-ol.
| Compound Name | 3-(1-pyridin-2-ylethylamino)propan-1-ol |
|---|---|
| PubChem CID | 2772086 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 3-(1-pyridin-2-ylethylamino)propan-1-ol |
| SMILES | CC(NCCCO)c1ccccn1 |
| InChI | InChI=1S/C10H16N2O/c1-9(11-7-4-8-13)10-5-2-3-6-12-10/h2-3,5-6,9,11,13H,4,7-8H2,1H3 |
| InChIKey | VTPSDNLWUCEVFT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|