C12H16N2 — CID 115872152
N-(1-pyridin-2-ylethyl)pent-4-yn-1-amine (PubChem CID 115872152) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is N-(1-pyridin-2-ylethyl)pent-4-yn-1-amine.
| Compound Name | N-(1-pyridin-2-ylethyl)pent-4-yn-1-amine |
|---|---|
| PubChem CID | 115872152 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N-(1-pyridin-2-ylethyl)pent-4-yn-1-amine |
| SMILES | C#CCCCNC(C)c1ccccn1 |
| InChI | InChI=1S/C12H16N2/c1-3-4-6-9-13-11(2)12-8-5-7-10-14-12/h1,5,7-8,10-11,13H,4,6,9H2,2H3 |
| InChIKey | NJWVWOUPWGMEIG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|