C15H25N3 — CID 43203794
3-piperidin-1-yl-N-(1-pyridin-2-ylethyl)propan-1-amine (PubChem CID 43203794) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is 3-piperidin-1-yl-N-(1-pyridin-2-ylethyl)propan-1-amine.
| Compound Name | 3-piperidin-1-yl-N-(1-pyridin-2-ylethyl)propan-1-amine |
|---|---|
| PubChem CID | 43203794 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 3-piperidin-1-yl-N-(1-pyridin-2-ylethyl)propan-1-amine |
| SMILES | CC(NCCCN1CCCCC1)c1ccccn1 |
| InChI | InChI=1S/C15H25N3/c1-14(15-8-3-4-9-17-15)16-10-7-13-18-11-5-2-6-12-18/h3-4,8-9,14,16H,2,5-7,10-13H2,1H3 |
| InChIKey | UMDFCJVLZHPGQA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|