C12H18N4O — CID 81406832
1-[2-[[(1R)-1-pyridin-2-ylethyl]amino]ethyl]imidazolidin-2-one (PubChem CID 81406832) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-[2-[[(1R)-1-pyridin-2-ylethyl]amino]ethyl]imidazolidin-2-one.
| Compound Name | 1-[2-[[(1R)-1-pyridin-2-ylethyl]amino]ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 81406832 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 1-[2-[[(1R)-1-pyridin-2-ylethyl]amino]ethyl]imidazolidin-2-one |
| SMILES | C[C@@H](NCCN1CCNC1=O)c1ccccn1 |
| InChI | InChI=1S/C12H18N4O/c1-10(11-4-2-3-5-14-11)13-6-8-16-9-7-15-12(16)17/h2-5,10,13H,6-9H2,1H3,(H,15,17)/t10-/m1/s1 |
| InChIKey | OICYQMPTWNLSBA-SNVBAGLBSA-N |
| XLogP | 0.76 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |