C13H22N2 — CID 81399957
3,3-dimethyl-N-[(1S)-1-pyridin-2-ylethyl]butan-1-amine (PubChem CID 81399957) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 3,3-dimethyl-N-[(1S)-1-pyridin-2-ylethyl]butan-1-amine.
| Compound Name | 3,3-dimethyl-N-[(1S)-1-pyridin-2-ylethyl]butan-1-amine |
|---|---|
| PubChem CID | 81399957 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 3,3-dimethyl-N-[(1S)-1-pyridin-2-ylethyl]butan-1-amine |
| SMILES | C[C@H](NCCC(C)(C)C)c1ccccn1 |
| InChI | InChI=1S/C13H22N2/c1-11(12-7-5-6-9-15-12)14-10-8-13(2,3)4/h5-7,9,11,14H,8,10H2,1-4H3/t11-/m0/s1 |
| InChIKey | AMFKXUMHYGOHSN-NSHDSACASA-N |
| XLogP | 3.17 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |