C11H18N2O — CID 81401299
1-[[(1S)-1-pyridin-2-ylethyl]amino]butan-2-ol (PubChem CID 81401299) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-[[(1S)-1-pyridin-2-ylethyl]amino]butan-2-ol.
| Compound Name | 1-[[(1S)-1-pyridin-2-ylethyl]amino]butan-2-ol |
|---|---|
| PubChem CID | 81401299 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 1-[[(1S)-1-pyridin-2-ylethyl]amino]butan-2-ol |
| SMILES | CCC(O)CN[C@@H](C)c1ccccn1 |
| InChI | InChI=1S/C11H18N2O/c1-3-10(14)8-13-9(2)11-6-4-5-7-12-11/h4-7,9-10,13-14H,3,8H2,1-2H3/t9-,10?/m0/s1 |
| InChIKey | AQCFATORVVQDQJ-RGURZIINSA-N |
| XLogP | 1.50 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |