C17H26N2S — CID 43078478
N-[1-(1,3-benzothiazol-2-yl)ethyl]-2-ethylhexan-1-amine (PubChem CID 43078478) has the molecular formula C17H26N2S and a molecular weight of 290.48 g/mol. Its IUPAC name is N-[1-(1,3-benzothiazol-2-yl)ethyl]-2-ethylhexan-1-amine.
| Compound Name | N-[1-(1,3-benzothiazol-2-yl)ethyl]-2-ethylhexan-1-amine |
|---|---|
| PubChem CID | 43078478 |
| Molecular Formula | C17H26N2S |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | N-[1-(1,3-benzothiazol-2-yl)ethyl]-2-ethylhexan-1-amine |
| SMILES | CCCCC(CC)CNC(C)c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H26N2S/c1-4-6-9-14(5-2)12-18-13(3)17-19-15-10-7-8-11-16(15)20-17/h7-8,10-11,13-14,18H,4-6,9,12H2,1-3H3 |
| InChIKey | ZEZCFWGQGULAJF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |