C16H24N2OS — CID 103787462
3-[[1-(1,3-benzothiazol-2-yl)ethylamino]methyl]hexan-1-ol (PubChem CID 103787462) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is 3-[[1-(1,3-benzothiazol-2-yl)ethylamino]methyl]hexan-1-ol.
| Compound Name | 3-[[1-(1,3-benzothiazol-2-yl)ethylamino]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 103787462 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 3-[[1-(1,3-benzothiazol-2-yl)ethylamino]methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNC(C)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H24N2OS/c1-3-6-13(9-10-19)11-17-12(2)16-18-14-7-4-5-8-15(14)20-16/h4-5,7-8,12-13,17,19H,3,6,9-11H2,1-2H3 |
| InChIKey | WDZLIWSODBIFRP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |