C14H20N2OS — CID 113261488
1-[1-(1,3-benzothiazol-2-yl)ethylamino]pentan-2-ol (PubChem CID 113261488) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is 1-[1-(1,3-benzothiazol-2-yl)ethylamino]pentan-2-ol.
| Compound Name | 1-[1-(1,3-benzothiazol-2-yl)ethylamino]pentan-2-ol |
|---|---|
| PubChem CID | 113261488 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 1-[1-(1,3-benzothiazol-2-yl)ethylamino]pentan-2-ol |
| SMILES | CCCC(O)CNC(C)c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H20N2OS/c1-3-6-11(17)9-15-10(2)14-16-12-7-4-5-8-13(12)18-14/h4-5,7-8,10-11,15,17H,3,6,9H2,1-2H3 |
| InChIKey | XNTSILBIXAUIIA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |