C12H16N2OS — CID 115622903
1-(1,3-benzothiazol-2-ylamino)pentan-2-ol (PubChem CID 115622903) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylamino)pentan-2-ol.
| Compound Name | 1-(1,3-benzothiazol-2-ylamino)pentan-2-ol |
|---|---|
| PubChem CID | 115622903 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylamino)pentan-2-ol |
| SMILES | CCCC(O)CNc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H16N2OS/c1-2-5-9(15)8-13-12-14-10-6-3-4-7-11(10)16-12/h3-4,6-7,9,15H,2,5,8H2,1H3,(H,13,14) |
| InChIKey | VHZSCXAHCZZIPJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |