C10H12N2O2S — CID 167929863
1-(1,3-benzothiazol-2-ylamino)oxypropan-2-ol (PubChem CID 167929863) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylamino)oxypropan-2-ol.
| Compound Name | 1-(1,3-benzothiazol-2-ylamino)oxypropan-2-ol |
|---|---|
| PubChem CID | 167929863 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylamino)oxypropan-2-ol |
| SMILES | CC(O)CONc1nc2ccccc2s1 |
| InChI | InChI=1S/C10H12N2O2S/c1-7(13)6-14-12-10-11-8-4-2-3-5-9(8)15-10/h2-5,7,13H,6H2,1H3,(H,11,12) |
| InChIKey | JXCYJQFGLDYHFA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|