C9H8F2N2S — CID 79098958
N-(2,2-difluoroethyl)-1,3-benzothiazol-2-amine (PubChem CID 79098958) has the molecular formula C9H8F2N2S and a molecular weight of 214.24 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-1,3-benzothiazol-2-amine.
| Compound Name | N-(2,2-difluoroethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79098958 |
| Molecular Formula | C9H8F2N2S |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | N-(2,2-difluoroethyl)-1,3-benzothiazol-2-amine |
| SMILES | FC(F)CNc1nc2ccccc2s1 |
| InChI | InChI=1S/C9H8F2N2S/c10-8(11)5-12-9-13-6-3-1-2-4-7(6)14-9/h1-4,8H,5H2,(H,12,13) |
| InChIKey | ITWSTHZJBQURQW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |