C10H12N2S2 — CID 101455251
3-(1,3-benzothiazol-2-ylamino)propane-1-thiol (PubChem CID 101455251) has the molecular formula C10H12N2S2 and a molecular weight of 224.35 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylamino)propane-1-thiol.
| Compound Name | 3-(1,3-benzothiazol-2-ylamino)propane-1-thiol |
|---|---|
| PubChem CID | 101455251 |
| Molecular Formula | C10H12N2S2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylamino)propane-1-thiol |
| SMILES | SCCCNc1nc2ccccc2s1 |
| InChI | InChI=1S/C10H12N2S2/c13-7-3-6-11-10-12-8-4-1-2-5-9(8)14-10/h1-2,4-5,13H,3,6-7H2,(H,11,12) |
| InChIKey | ASQWLOBNTOKKMU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|