C9H11ClN2S2 — CID 44537905
2-(1,3-benzothiazol-2-ylamino)ethanethiol;hydrochloride (PubChem CID 44537905) has the molecular formula C9H11ClN2S2 and a molecular weight of 246.79 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylamino)ethanethiol;hydrochloride.
| Compound Name | 2-(1,3-benzothiazol-2-ylamino)ethanethiol;hydrochloride |
|---|---|
| PubChem CID | 44537905 |
| Molecular Formula | C9H11ClN2S2 |
| Molecular Weight | 246.79 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylamino)ethanethiol;hydrochloride |
| SMILES | Cl.SCCNc1nc2ccccc2s1 |
| InChI | InChI=1S/C9H10N2S2.ClH/c12-6-5-10-9-11-7-3-1-2-4-8(7)13-9;/h1-4,12H,5-6H2,(H,10,11);1H |
| InChIKey | LTRASBFAHYVFGQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.79 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|