C14H14N4S — CID 37105021
N'-(1,3-benzothiazol-2-yl)-N-pyridin-2-ylethane-1,2-diamine (PubChem CID 37105021) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is N'-(1,3-benzothiazol-2-yl)-N-pyridin-2-ylethane-1,2-diamine.
| Compound Name | N'-(1,3-benzothiazol-2-yl)-N-pyridin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 37105021 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | N'-(1,3-benzothiazol-2-yl)-N-pyridin-2-ylethane-1,2-diamine |
| SMILES | c1ccc(NCCNc2nc3ccccc3s2)nc1 |
| InChI | InChI=1S/C14H14N4S/c1-2-6-12-11(5-1)18-14(19-12)17-10-9-16-13-7-3-4-8-15-13/h1-8H,9-10H2,(H,15,16)(H,17,18) |
| InChIKey | GZMWKGCFAHVHMZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|