C13H11N3S — CID 42281689
N-(pyridin-2-ylmethyl)-1,3-benzothiazol-2-amine (PubChem CID 42281689) has the molecular formula C13H11N3S and a molecular weight of 241.32 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-1,3-benzothiazol-2-amine.
| Compound Name | N-(pyridin-2-ylmethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 42281689 |
| Molecular Formula | C13H11N3S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-1,3-benzothiazol-2-amine |
| SMILES | c1ccc(CNc2nc3ccccc3s2)nc1 |
| InChI | InChI=1S/C13H11N3S/c1-2-7-12-11(6-1)16-13(17-12)15-9-10-5-3-4-8-14-10/h1-8H,9H2,(H,15,16) |
| InChIKey | MNMLDERTJCOFJS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |