C15H14N2S — CID 32680270
N-[(2-methylphenyl)methyl]-1,3-benzothiazol-2-amine (PubChem CID 32680270) has the molecular formula C15H14N2S and a molecular weight of 254.36 g/mol. Its IUPAC name is N-[(2-methylphenyl)methyl]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(2-methylphenyl)methyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 32680270 |
| Molecular Formula | C15H14N2S |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | N-[(2-methylphenyl)methyl]-1,3-benzothiazol-2-amine |
| SMILES | Cc1ccccc1CNc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H14N2S/c1-11-6-2-3-7-12(11)10-16-15-17-13-8-4-5-9-14(13)18-15/h2-9H,10H2,1H3,(H,16,17) |
| InChIKey | WLBPEVZRFSVDDN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |