C12H14N2S — CID 60723741
4-methyl-N-[(2-methylphenyl)methyl]-1,3-thiazol-2-amine (PubChem CID 60723741) has the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 4-methyl-N-[(2-methylphenyl)methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-N-[(2-methylphenyl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 60723741 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 4-methyl-N-[(2-methylphenyl)methyl]-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NCc2ccccc2C)n1 |
| InChI | InChI=1S/C12H14N2S/c1-9-5-3-4-6-11(9)7-13-12-14-10(2)8-15-12/h3-6,8H,7H2,1-2H3,(H,13,14) |
| InChIKey | VQGUVNLOXISVLG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |