C13H16N2O2S — CID 63363217
N-[(2,4-dimethoxyphenyl)methyl]-4-methyl-1,3-thiazol-2-amine (PubChem CID 63363217) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 63363217 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-4-methyl-1,3-thiazol-2-amine |
| SMILES | COc1ccc(CNc2nc(C)cs2)c(OC)c1 |
| InChI | InChI=1S/C13H16N2O2S/c1-9-8-18-13(15-9)14-7-10-4-5-11(16-2)6-12(10)17-3/h4-6,8H,7H2,1-3H3,(H,14,15) |
| InChIKey | NGQAXZYYGIPPIZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |