C18H19N3O2 — CID 57476570
N-[(2,4-dimethoxyphenyl)methyl]-6-methylquinoxalin-2-amine (PubChem CID 57476570) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-6-methylquinoxalin-2-amine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-6-methylquinoxalin-2-amine |
|---|---|
| PubChem CID | 57476570 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-6-methylquinoxalin-2-amine |
| SMILES | COc1ccc(CNc2cnc3cc(C)ccc3n2)c(OC)c1 |
| InChI | InChI=1S/C18H19N3O2/c1-12-4-7-15-16(8-12)19-11-18(21-15)20-10-13-5-6-14(22-2)9-17(13)23-3/h4-9,11H,10H2,1-3H3,(H,20,21) |
| InChIKey | CBUFXFPZRODFOI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |