C15H21N3O2 — CID 145306239
N-[(2,4-dimethoxyphenyl)methyl]pyrimidin-4-amine;ethane (PubChem CID 145306239) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]pyrimidin-4-amine;ethane.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]pyrimidin-4-amine;ethane |
|---|---|
| PubChem CID | 145306239 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]pyrimidin-4-amine;ethane |
| SMILES | CC.COc1ccc(CNc2ccncn2)c(OC)c1 |
| InChI | InChI=1S/C13H15N3O2.C2H6/c1-17-11-4-3-10(12(7-11)18-2)8-15-13-5-6-14-9-16-13;1-2/h3-7,9H,8H2,1-2H3,(H,14,15,16);1-2H3 |
| InChIKey | VYLWYPOKMUHBHA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |