C12H14N2O2S — CID 66652908
N-[(2,4-dimethoxyphenyl)methyl]-1,2-thiazol-5-amine (PubChem CID 66652908) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-1,2-thiazol-5-amine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-1,2-thiazol-5-amine |
|---|---|
| PubChem CID | 66652908 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-1,2-thiazol-5-amine |
| SMILES | COc1ccc(CNc2ccns2)c(OC)c1 |
| InChI | InChI=1S/C12H14N2O2S/c1-15-10-4-3-9(11(7-10)16-2)8-13-12-5-6-14-17-12/h3-7,13H,8H2,1-2H3 |
| InChIKey | DCKGGTHYCUMWGP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |