C17H21NO4 — CID 39427088
N-[(2,4-dimethoxyphenyl)methyl]-2,4-dimethoxyaniline (PubChem CID 39427088) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-2,4-dimethoxyaniline.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-2,4-dimethoxyaniline |
|---|---|
| PubChem CID | 39427088 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-2,4-dimethoxyaniline |
| SMILES | COc1ccc(CNc2ccc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C17H21NO4/c1-19-13-6-5-12(16(9-13)21-3)11-18-15-8-7-14(20-2)10-17(15)22-4/h5-10,18H,11H2,1-4H3 |
| InChIKey | VTQLHYMHXOXPLC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|