C15H14BrCl2NO2 — CID 107787753
4-bromo-2,3-dichloro-N-[(2,4-dimethoxyphenyl)methyl]aniline (PubChem CID 107787753) has the molecular formula C15H14BrCl2NO2 and a molecular weight of 391.09 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-[(2,4-dimethoxyphenyl)methyl]aniline.
| Compound Name | 4-bromo-2,3-dichloro-N-[(2,4-dimethoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 107787753 |
| Molecular Formula | C15H14BrCl2NO2 |
| Molecular Weight | 391.09 g/mol |
| Exact Mass | 388.96 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-[(2,4-dimethoxyphenyl)methyl]aniline |
| SMILES | COc1ccc(CNc2ccc(Br)c(Cl)c2Cl)c(OC)c1 |
| InChI | InChI=1S/C15H14BrCl2NO2/c1-20-10-4-3-9(13(7-10)21-2)8-19-12-6-5-11(16)14(17)15(12)18/h3-7,19H,8H2,1-2H3 |
| InChIKey | PDEATSPQZOJUGJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.09 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|