C14H11Br2Cl2NO — CID 107787860
4-bromo-N-[(5-bromo-2-methoxyphenyl)methyl]-2,3-dichloroaniline (PubChem CID 107787860) has the molecular formula C14H11Br2Cl2NO and a molecular weight of 439.96 g/mol. Its IUPAC name is 4-bromo-N-[(5-bromo-2-methoxyphenyl)methyl]-2,3-dichloroaniline.
| Compound Name | 4-bromo-N-[(5-bromo-2-methoxyphenyl)methyl]-2,3-dichloroaniline |
|---|---|
| PubChem CID | 107787860 |
| Molecular Formula | C14H11Br2Cl2NO |
| Molecular Weight | 439.96 g/mol |
| Exact Mass | 436.86 |
| IUPAC Name | 4-bromo-N-[(5-bromo-2-methoxyphenyl)methyl]-2,3-dichloroaniline |
| SMILES | COc1ccc(Br)cc1CNc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C14H11Br2Cl2NO/c1-20-12-5-2-9(15)6-8(12)7-19-11-4-3-10(16)13(17)14(11)18/h2-6,19H,7H2,1H3 |
| InChIKey | ZUJKFMYFHMSJAS-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.96 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|