C15H15ClFNO2 — CID 43716456
4-chloro-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoroaniline (PubChem CID 43716456) has the molecular formula C15H15ClFNO2 and a molecular weight of 295.74 g/mol. Its IUPAC name is 4-chloro-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoroaniline.
| Compound Name | 4-chloro-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoroaniline |
|---|---|
| PubChem CID | 43716456 |
| Molecular Formula | C15H15ClFNO2 |
| Molecular Weight | 295.74 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 4-chloro-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoroaniline |
| SMILES | COc1ccc(CNc2ccc(Cl)cc2F)c(OC)c1 |
| InChI | InChI=1S/C15H15ClFNO2/c1-19-12-5-3-10(15(8-12)20-2)9-18-14-6-4-11(16)7-13(14)17/h3-8,18H,9H2,1-2H3 |
| InChIKey | KIUPRWSQCWDIPP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.74 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |