C16H18BrNO3 — CID 61061133
5-bromo-N-[(2,4-dimethoxyphenyl)methyl]-2-methoxyaniline (PubChem CID 61061133) has the molecular formula C16H18BrNO3 and a molecular weight of 352.23 g/mol. Its IUPAC name is 5-bromo-N-[(2,4-dimethoxyphenyl)methyl]-2-methoxyaniline.
| Compound Name | 5-bromo-N-[(2,4-dimethoxyphenyl)methyl]-2-methoxyaniline |
|---|---|
| PubChem CID | 61061133 |
| Molecular Formula | C16H18BrNO3 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 5-bromo-N-[(2,4-dimethoxyphenyl)methyl]-2-methoxyaniline |
| SMILES | COc1ccc(CNc2cc(Br)ccc2OC)c(OC)c1 |
| InChI | InChI=1S/C16H18BrNO3/c1-19-13-6-4-11(16(9-13)21-3)10-18-14-8-12(17)5-7-15(14)20-2/h4-9,18H,10H2,1-3H3 |
| InChIKey | BVGOITNZBRQWCY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |